CAS 1171917-39-7 is the registry number for 1-Boc-6-bromo-3-cyanoacetylindole. Offered by: Biosynth. Available pack sizes: 500mg.
Tert-butyl 6-bromo-3-(2-cyanoacetyl)indole-1-carboxylate (CAS 1171917-39-7) is a chemical compound with the molecular formula C16H15BrN2O3 and a molecular weight of 363.21 g/mol. IUPAC name: tert-butyl 6-bromo-3-(2-cyanoacetyl)indole-1-carboxylate. InChIKey: ZKJALZBXEBITSV-UHFFFAOYSA-N.
| Molecular formula | C16H15BrN2O3 |
|---|---|
| Molecular weight | 363.21 g/mol |
| IUPAC name | tert-butyl 6-bromo-3-(2-cyanoacetyl)indole-1-carboxylate |
| InChIKey | ZKJALZBXEBITSV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=C(C=C2)Br)C(=O)CC#N |
Computed by PubChem (NCBI)