CAS 1171919-95-1 is the registry number for Methyl 3-(6-bromo-5-pivalamidopyridin-3-yl)-acrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl (E)-3-[6-bromo-5-(2,2-dimethylpropanoylamino)-3-pyridinyl]prop-2-enoate (CAS 1171919-95-1) is a chemical compound with the molecular formula C14H17BrN2O3 and a molecular weight of 341.20 g/mol. IUPAC name: methyl (E)-3-[6-bromo-5-(2,2-dimethylpropanoylamino)-3-pyridinyl]prop-2-enoate. InChIKey: RGHUFWUEXYUPNE-AATRIKPKSA-N.
| Molecular formula | C14H17BrN2O3 |
|---|---|
| Molecular weight | 341.20 g/mol |
| IUPAC name | methyl (E)-3-[6-bromo-5-(2,2-dimethylpropanoylamino)-3-pyridinyl]prop-2-enoate |
| InChIKey | RGHUFWUEXYUPNE-AATRIKPKSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(N=CC(=C1)/C=C/C(=O)OC)Br |
Computed by PubChem (NCBI)