CAS 1171920-06-1 is the registry number for tert-Butyl (5-pivalamidopyridin-3-yl)-methylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-[[5-(2,2-dimethylpropanoylamino)-3-pyridinyl]methyl]carbamate (CAS 1171920-06-1) is a chemical compound with the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. IUPAC name: tert-butyl N-[[5-(2,2-dimethylpropanoylamino)-3-pyridinyl]methyl]carbamate. InChIKey: KEIVTOMJUMVZDI-UHFFFAOYSA-N.
| Molecular formula | C16H25N3O3 |
|---|---|
| Molecular weight | 307.39 g/mol |
| IUPAC name | tert-butyl N-[[5-(2,2-dimethylpropanoylamino)-3-pyridinyl]methyl]carbamate |
| InChIKey | KEIVTOMJUMVZDI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CN=CC(=C1)CNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)