CAS 1171920-42-5 is the registry number for 2-((tert-Butyldimethylsilyloxy)methyl)-6-chlorofuro[3,2-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl-[(6-chlorofuro[3,2-b]pyridin-2-yl)methoxy]-dimethylsilane (CAS 1171920-42-5) is a chemical compound with the molecular formula C14H20ClNO2Si and a molecular weight of 297.85 g/mol. IUPAC name: tert-butyl-[(6-chlorofuro[3,2-b]pyridin-2-yl)methoxy]-dimethylsilane. InChIKey: PLUKXQYGIFUFCS-UHFFFAOYSA-N.
| Molecular formula | C14H20ClNO2Si |
|---|---|
| Molecular weight | 297.85 g/mol |
| IUPAC name | tert-butyl-[(6-chlorofuro[3,2-b]pyridin-2-yl)methoxy]-dimethylsilane |
| InChIKey | PLUKXQYGIFUFCS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CC2=C(O1)C=C(C=N2)Cl |
Computed by PubChem (NCBI)