CAS 1171920-47-0 is the registry number for 2-((tert-Butyldimethylsilyloxy)methyl)-furo[3,2-b]pyridin-6-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-[[tert-butyl(dimethyl)silyl]oxymethyl]furo[3,2-b]pyridin-6-ol (CAS 1171920-47-0) is a chemical compound with the molecular formula C14H21NO3Si and a molecular weight of 279.41 g/mol. IUPAC name: 2-[[tert-butyl(dimethyl)silyl]oxymethyl]furo[3,2-b]pyridin-6-ol. InChIKey: PVBHQEAUBNFSDB-UHFFFAOYSA-N.
| Molecular formula | C14H21NO3Si |
|---|---|
| Molecular weight | 279.41 g/mol |
| IUPAC name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]furo[3,2-b]pyridin-6-ol |
| InChIKey | PVBHQEAUBNFSDB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CC2=C(O1)C=C(C=N2)O |
Computed by PubChem (NCBI)