Products 1171922-90-9

CAS 1171922-90-9 is the registry number for 4-(4-Bromo-5-methyl-3-nitro-1h-pyrazol-1-yl)butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(4-bromo-5-methyl-3-nitropyrazol-1-yl)butanoic acid (CAS 1171922-90-9) is a chemical compound with the molecular formula C8H10BrN3O4 and a molecular weight of 292.09 g/mol. IUPAC name: 4-(4-bromo-5-methyl-3-nitropyrazol-1-yl)butanoic acid. InChIKey: URSLCWIGOHLECM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10BrN3O4
Molecular weight292.09 g/mol
IUPAC name4-(4-bromo-5-methyl-3-nitropyrazol-1-yl)butanoic acid
InChIKeyURSLCWIGOHLECM-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1CCCC(=O)O)[N+](=O)[O-])Br

Computed by PubChem (NCBI)