Products 1171923-94-6

CAS 1171923-94-6 is the registry number for 2-[3-(2-Chloro-phenyl)-propyl]-6-methoxy-benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[3-(2-chlorophenyl)propyl]-6-methoxybenzoic acid (CAS 1171923-94-6) is a chemical compound with the molecular formula C17H17ClO3 and a molecular weight of 304.8 g/mol. IUPAC name: 2-[3-(2-chlorophenyl)propyl]-6-methoxybenzoic acid. InChIKey: RSAHBULAKLKDCK-UHFFFAOYSA-N.

Identity
Molecular formulaC17H17ClO3
Molecular weight304.8 g/mol
IUPAC name2-[3-(2-chlorophenyl)propyl]-6-methoxybenzoic acid
InChIKeyRSAHBULAKLKDCK-UHFFFAOYSA-N
SMILESCOC1=CC=CC(=C1C(=O)O)CCCC2=CC=CC=C2Cl

Computed by PubChem (NCBI)