CAS 1171924-91-6 is the registry number for Methyl 2-(2,4-dichlorophenethyl)-6-methoxybenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[2-(2,4-dichlorophenyl)ethyl]-6-methoxybenzoate (CAS 1171924-91-6) is a chemical compound with the molecular formula C17H16Cl2O3 and a molecular weight of 339.2 g/mol. IUPAC name: methyl 2-[2-(2,4-dichlorophenyl)ethyl]-6-methoxybenzoate. InChIKey: RQEFUYGEENXSCX-UHFFFAOYSA-N.
| Molecular formula | C17H16Cl2O3 |
|---|---|
| Molecular weight | 339.2 g/mol |
| IUPAC name | methyl 2-[2-(2,4-dichlorophenyl)ethyl]-6-methoxybenzoate |
| InChIKey | RQEFUYGEENXSCX-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1C(=O)OC)CCC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)