CAS 1171930-30-5 is the registry number for 2-(2,4-Difluorophenyl)-1,3,4-oxadiazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
2-(2,4-difluorophenyl)-1,3,4-oxadiazole (CAS 1171930-30-5) is a chemical compound with the molecular formula C8H4F2N2O and a molecular weight of 182.13 g/mol. IUPAC name: 2-(2,4-difluorophenyl)-1,3,4-oxadiazole. InChIKey: MRHPBLVDSJLJND-UHFFFAOYSA-N.
| Molecular formula | C8H4F2N2O |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)-1,3,4-oxadiazole |
| InChIKey | MRHPBLVDSJLJND-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=NN=CO2 |
Computed by PubChem (NCBI)