CAS 1171995-49-5 appears in our catalog under these names: (R,S)-1-Amino-2-phenylethyl-phosphonic acid diphenyl ester hydrochloride, 95%, (R,S)-1-AMino-2-phenylethyl-phosphonic acid diphenyl ester HCl, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
1-diphenoxyphosphoryl-2-phenylethanamine;hydrochloride (CAS 1171995-49-5) is a chemical compound with the molecular formula C20H21ClNO3P and a molecular weight of 389.8 g/mol. IUPAC name: 1-diphenoxyphosphoryl-2-phenylethanamine;hydrochloride. InChIKey: QASSQNFAQQHNNH-UHFFFAOYSA-N.
| Molecular formula | C20H21ClNO3P |
|---|---|
| Molecular weight | 389.8 g/mol |
| IUPAC name | 1-diphenoxyphosphoryl-2-phenylethanamine;hydrochloride |
| InChIKey | QASSQNFAQQHNNH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(N)P(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)