CAS 1172-76-5 appears in our catalog under these names: 1,2-Dimethyl-1,1,2,2-tetraphenyldisilane, 95%, 1,2–Dimethyl–1,1,2,2–tetraphenyldisilane, 1,2-Dimethyl-1,1,2,2-tetraphenyldisilane, >98.0%(GC), 1,2-Dimethyl-1,1,2,2-tetraphenyldisilane 98%, 1,2-Dimethyl-1,1,2,2-tetraphenyldisilane, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 25g.
Methyl-[methyl(diphenyl)silyl]-diphenylsilane (CAS 1172-76-5) is a chemical compound with the molecular formula C26H26Si2 and a molecular weight of 394.7 g/mol. IUPAC name: methyl-[methyl(diphenyl)silyl]-diphenylsilane. InChIKey: JNZRJYXUMDPPRK-UHFFFAOYSA-N.
| Molecular formula | C26H26Si2 |
|---|---|
| Molecular weight | 394.7 g/mol |
| IUPAC name | methyl-[methyl(diphenyl)silyl]-diphenylsilane |
| InChIKey | JNZRJYXUMDPPRK-UHFFFAOYSA-N |
| SMILES | C[Si](C1=CC=CC=C1)(C2=CC=CC=C2)[Si](C)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)