CAS 1172003-50-7 appears in our catalog under these names: Potassium (4-benzamido-5,6-dimethylfuro[2,3-d]pyrimidin-2-yl)sulfanide, 95%, Potassium {4-benzamido-5,6-dimethylfuro(2,3-d)pyrimidin-2-yl}sulfanide, 95%, Potassium {4-benzamido-5,6-dimethylfuro(2,3-d)pyrimidin-2-yl}sulfanide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
Potassium 4-benzamido-5,6-dimethylfuro[2,3-d]pyrimidine-2-thiolate (CAS 1172003-50-7) is a chemical compound with the molecular formula C15H12KN3O2S and a molecular weight of 337.4 g/mol. IUPAC name: potassium 4-benzamido-5,6-dimethylfuro[2,3-d]pyrimidine-2-thiolate. InChIKey: GCJILBAWVDKBED-UHFFFAOYSA-M.
| Molecular formula | C15H12KN3O2S |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | potassium 4-benzamido-5,6-dimethylfuro[2,3-d]pyrimidine-2-thiolate |
| InChIKey | GCJILBAWVDKBED-UHFFFAOYSA-M |
| SMILES | CC1=C(OC2=NC(=NC(=C12)NC(=O)C3=CC=CC=C3)[S-])C.[K+] |
Computed by PubChem (NCBI)