Products 1172304-90-3

CAS 1172304-90-3 appears in our catalog under these names: 4-Formylpiperazine-1-sulfonyl chloride, 95%, 4-Formylpiperazine-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.

4-formylpiperazine-1-sulfonyl chloride (CAS 1172304-90-3) is a chemical compound with the molecular formula C5H9ClN2O3S and a molecular weight of 212.66 g/mol. IUPAC name: 4-formylpiperazine-1-sulfonyl chloride. InChIKey: KDYQOCOXSQJWHL-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClN2O3S
Molecular weight212.66 g/mol
IUPAC name4-formylpiperazine-1-sulfonyl chloride
InChIKeyKDYQOCOXSQJWHL-UHFFFAOYSA-N
SMILESC1CN(CCN1C=O)S(=O)(=O)Cl

Computed by PubChem (NCBI)