CAS 1172364-87-2 is the registry number for 2-Difluoromethanesulfonylaniline hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg.
2-(difluoromethylsulfonyl)aniline;hydrochloride (CAS 1172364-87-2) is a chemical compound with the molecular formula C7H8ClF2NO2S and a molecular weight of 243.66 g/mol. IUPAC name: 2-(difluoromethylsulfonyl)aniline;hydrochloride. InChIKey: LSBGBCYXFNZFJU-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF2NO2S |
|---|---|
| Molecular weight | 243.66 g/mol |
| IUPAC name | 2-(difluoromethylsulfonyl)aniline;hydrochloride |
| InChIKey | LSBGBCYXFNZFJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)S(=O)(=O)C(F)F.Cl |
Computed by PubChem (NCBI)