CAS 1172490-52-6 appears in our catalog under these names: 5,7-Dichloro-4-hydrazinoquinoline hydrochloride, 95%, 5,7-Dichloro-4-hydrazinylquinoline hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(5,7-dichloroquinolin-4-yl)hydrazine;hydrochloride (CAS 1172490-52-6) is a chemical compound with the molecular formula C9H8Cl3N3 and a molecular weight of 264.5 g/mol. IUPAC name: (5,7-dichloroquinolin-4-yl)hydrazine;hydrochloride. InChIKey: YSNOEGVRKSICDK-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl3N3 |
|---|---|
| Molecular weight | 264.5 g/mol |
| IUPAC name | (5,7-dichloroquinolin-4-yl)hydrazine;hydrochloride |
| InChIKey | YSNOEGVRKSICDK-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C=C(C=C(C2=C1NN)Cl)Cl.Cl |
Computed by PubChem (NCBI)