CAS 1172531-47-3 is the registry number for 5-(3,5-Di-tert-butylphenyl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3,5-ditert-butylphenyl)-1,3,4-thiadiazol-2-amine (CAS 1172531-47-3) is a chemical compound with the molecular formula C16H23N3S and a molecular weight of 289.4 g/mol. IUPAC name: 5-(3,5-ditert-butylphenyl)-1,3,4-thiadiazol-2-amine. InChIKey: SCGIURQNAWEGBA-UHFFFAOYSA-N.
| Molecular formula | C16H23N3S |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | 5-(3,5-ditert-butylphenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | SCGIURQNAWEGBA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C2=NN=C(S2)N)C(C)(C)C |
Computed by PubChem (NCBI)