CAS 1172549-33-5 is the registry number for 6-Chloro-7-(piperazine-1-sulfonyl)-3,4-dihydro-2h-1,4-benzoxazin-3-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
6-chloro-7-piperazin-1-ylsulfonyl-4H-1,4-benzoxazin-3-one;hydrochloride (CAS 1172549-33-5) is a chemical compound with the molecular formula C12H15Cl2N3O4S and a molecular weight of 368.2 g/mol. IUPAC name: 6-chloro-7-piperazin-1-ylsulfonyl-4H-1,4-benzoxazin-3-one;hydrochloride. InChIKey: IRQGVHNXZNWGEM-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2N3O4S |
|---|---|
| Molecular weight | 368.2 g/mol |
| IUPAC name | 6-chloro-7-piperazin-1-ylsulfonyl-4H-1,4-benzoxazin-3-one;hydrochloride |
| InChIKey | IRQGVHNXZNWGEM-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=C(C=C3C(=C2)OCC(=O)N3)Cl.Cl |
Computed by PubChem (NCBI)