CAS 1172639-14-3 appears in our catalog under these names: 2-(3,4,5-Trifluorophenyl)cyclohexanone, 95%, 2-(3,4,5-Trifluorophenyl)cyclohexanone. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(3,4,5-trifluorophenyl)cyclohexan-1-one (CAS 1172639-14-3) is a chemical compound with the molecular formula C12H11F3O and a molecular weight of 228.21 g/mol. IUPAC name: 2-(3,4,5-trifluorophenyl)cyclohexan-1-one. InChIKey: UUYBOSTZSMQZDL-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O |
|---|---|
| Molecular weight | 228.21 g/mol |
| IUPAC name | 2-(3,4,5-trifluorophenyl)cyclohexan-1-one |
| InChIKey | UUYBOSTZSMQZDL-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C(C1)C2=CC(=C(C(=C2)F)F)F |
Computed by PubChem (NCBI)