CAS 117269-72-4 is the registry number for 3–Cyanobenzylzinc bromide solution. Offered by: GLPBio. Available pack sizes: 50ml.
Bromozinc(1+);3-methanidylbenzonitrile (CAS 117269-72-4) is a chemical compound with the molecular formula C8H6BrNZn and a molecular weight of 261.4 g/mol. IUPAC name: bromozinc(1+);3-methanidylbenzonitrile. InChIKey: DOAJWWPVOOHMFV-UHFFFAOYSA-M.
| Molecular formula | C8H6BrNZn |
|---|---|
| Molecular weight | 261.4 g/mol |
| IUPAC name | bromozinc(1+);3-methanidylbenzonitrile |
| InChIKey | DOAJWWPVOOHMFV-UHFFFAOYSA-M |
| SMILES | [CH2-]C1=CC(=CC=C1)C#N.[Zn+]Br |
Computed by PubChem (NCBI)