CAS 117272-80-7 is the registry number for S-(2-Chlorophenyl) 2-chlorobenzenesulfinothioate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-2-(2-chlorophenyl)sulfinylsulfanylbenzene (CAS 117272-80-7) is a chemical compound with the molecular formula C12H8Cl2OS2 and a molecular weight of 303.2 g/mol. IUPAC name: 1-chloro-2-(2-chlorophenyl)sulfinylsulfanylbenzene. InChIKey: ZKGVNZUFXXVSAL-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2OS2 |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | 1-chloro-2-(2-chlorophenyl)sulfinylsulfanylbenzene |
| InChIKey | ZKGVNZUFXXVSAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)SS(=O)C2=CC=CC=C2Cl)Cl |
Computed by PubChem (NCBI)