CAS 117280-85-0 is the registry number for 4-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Benzyl 2-(nitromethoxy)-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate (CAS 117280-85-0) is a chemical compound with the molecular formula C17H19N3O7 and a molecular weight of 377.3 g/mol. IUPAC name: benzyl 2-(nitromethoxy)-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate. InChIKey: BXISRYFWBYMHIA-UHFFFAOYSA-N.
| Molecular formula | C17H19N3O7 |
|---|---|
| Molecular weight | 377.3 g/mol |
| IUPAC name | benzyl 2-(nitromethoxy)-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
| InChIKey | BXISRYFWBYMHIA-UHFFFAOYSA-N |
| SMILES | C1CN(CCC12CC(=O)N(C2=O)OC[N+](=O)[O-])C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)