CAS 1172854-54-4 appears in our catalog under these names: Ns-3-008 (hydrochloride), 95%, NS–3–008 hydrochloride, NS-3-008 hydrochloride/ 98.68% (existing batch purity), Ns-3-008 hydrochloride, NS-3-008 HCl 99%. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 100mg, 10mg, 10mM (in 1ml dmso), 5mg, 50mg, 25mg, 200mg, 1mg.
2-benzyl-1-hexylguanidine;hydrochloride (CAS 1172854-54-4) is a chemical compound with the molecular formula C14H24ClN3 and a molecular weight of 269.81 g/mol. IUPAC name: 2-benzyl-1-hexylguanidine;hydrochloride. InChIKey: UMIOAATZOCKZTH-UHFFFAOYSA-N.
| Molecular formula | C14H24ClN3 |
|---|---|
| Molecular weight | 269.81 g/mol |
| IUPAC name | 2-benzyl-1-hexylguanidine;hydrochloride |
| InChIKey | UMIOAATZOCKZTH-UHFFFAOYSA-N |
| SMILES | CCCCCCNC(=NCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)