CAS 1173018-57-9 appears in our catalog under these names: Azacitidine Impurity 10-13C3, Ammeline-13C3, 98% +98%atom%13C. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-diamino-(2,4,6-13C3)1H-1,3,5-triazin-2-one (CAS 1173018-57-9) is a chemical compound with the molecular formula C3H5N5O and a molecular weight of 130.08 g/mol. IUPAC name: 4,6-diamino-(2,4,6-13C3)1H-1,3,5-triazin-2-one. InChIKey: MASBWURJQFFLOO-VMIGTVKRSA-N.
| Molecular formula | C3H5N5O |
|---|---|
| Molecular weight | 130.08 g/mol |
| IUPAC name | 4,6-diamino-(2,4,6-13C3)1H-1,3,5-triazin-2-one |
| InChIKey | MASBWURJQFFLOO-VMIGTVKRSA-N |
| SMILES | [13C]1(=N[13C](=N[13C](=O)N1)N)N |
Computed by PubChem (NCBI)