CAS 1173018-88-6 is the registry number for rac 1,2-Diaminopropane-d6. Offered by: TRC. Available pack sizes: 25mg.
1,1,2,3,3,3-hexadeuteriopropane-1,2-diamine (CAS 1173018-88-6) is a chemical compound with the molecular formula C3H10N2 and a molecular weight of 80.16 g/mol. IUPAC name: 1,1,2,3,3,3-hexadeuteriopropane-1,2-diamine. InChIKey: AOHJOMMDDJHIJH-LIDOUZCJSA-N.
| Molecular formula | C3H10N2 |
|---|---|
| Molecular weight | 80.16 g/mol |
| IUPAC name | 1,1,2,3,3,3-hexadeuteriopropane-1,2-diamine |
| InChIKey | AOHJOMMDDJHIJH-LIDOUZCJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])N)N |
Computed by PubChem (NCBI)