CAS 1173019-27-6 is the registry number for 1,4-Dibromobutane-13C4. Offered by: TRC. Available pack sizes: 25mg.
1,4-dibromo(1,2,3,4-13C4)butane (CAS 1173019-27-6) is a chemical compound with the molecular formula C4H8Br2 and a molecular weight of 219.89 g/mol. IUPAC name: 1,4-dibromo(1,2,3,4-13C4)butane. InChIKey: ULTHEAFYOOPTTB-JCDJMFQYSA-N.
| Molecular formula | C4H8Br2 |
|---|---|
| Molecular weight | 219.89 g/mol |
| IUPAC name | 1,4-dibromo(1,2,3,4-13C4)butane |
| InChIKey | ULTHEAFYOOPTTB-JCDJMFQYSA-N |
| SMILES | [13CH2]([13CH2][13CH2]Br)[13CH2]Br |
Computed by PubChem (NCBI)