CAS 1173019-30-1 is the registry number for (3,4–dichlorophenyl–2,5,6–d3)methan–d2–ol. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
Dideuterio-(3,4-dichloro-2,5,6-trideuteriophenyl)methanol (CAS 1173019-30-1) is a chemical compound with the molecular formula C7H6Cl2O and a molecular weight of 182.06 g/mol. IUPAC name: dideuterio-(3,4-dichloro-2,5,6-trideuteriophenyl)methanol. InChIKey: FVJIUQSKXOYFKG-QUWGTZMWSA-N.
| Molecular formula | C7H6Cl2O |
|---|---|
| Molecular weight | 182.06 g/mol |
| IUPAC name | dideuterio-(3,4-dichloro-2,5,6-trideuteriophenyl)methanol |
| InChIKey | FVJIUQSKXOYFKG-QUWGTZMWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])O)[2H])Cl)Cl)[2H] |
Computed by PubChem (NCBI)