CAS 1173020-30-8 appears in our catalog under these names: Triphenyl-d15 Phosphate, Triphenyl Phosphate-d15, >95% (HPLC), Triphenyl phosphate D15, Triphenyl phosphate D15 100 µg/mL in Cyclohexane, Triphenyl-d15 Phosphate, 98 atom % D, min 98% Chemical Purity. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, CDN, GLPBio. Available pack sizes: on request, 10mg, 2,5mg, 50mg, 1ml, 0,5g, 0,25g, 2.5 mg.
Tris(2,3,4,5,6-pentadeuteriophenyl) phosphate (CAS 1173020-30-8) is a chemical compound with the molecular formula C18H15O4P and a molecular weight of 341.4 g/mol. IUPAC name: tris(2,3,4,5,6-pentadeuteriophenyl) phosphate. InChIKey: XZZNDPSIHUTMOC-KLHTYYPYSA-N.
| Molecular formula | C18H15O4P |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | tris(2,3,4,5,6-pentadeuteriophenyl) phosphate |
| InChIKey | XZZNDPSIHUTMOC-KLHTYYPYSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])OP(=O)(OC2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])OC3=C(C(=C(C(=C3[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)