CAS 1173021-13-0 appears in our catalog under these names: Leucomalachite Green-d6, >95% (HPLC), Leucomalachite Green-d6 (phenylmethylene-d6), 99 atom % D, min 98% Chemical Purity, LEUCOMALACHIT GREEN-D6 OEKANAL, Leucomalachite green-d6, 99.90%, D6-Leucomalachite green. Offered by: TRC, CDN, Sigma-Aldrich, MedChemExpress, HPC Standards. Available pack sizes: 100mg, 25mg, 0,01g, 0,005g, 10MG, 25 mg, 10 mg, 5 mg.
4-[deuterio-[4-(dimethylamino)phenyl]-(2,3,4,5,6-pentadeuteriophenyl)methyl]-N,N-dimethylaniline (CAS 1173021-13-0) is a chemical compound with the molecular formula C23H26N2 and a molecular weight of 336.5 g/mol. IUPAC name: 4-[deuterio-[4-(dimethylamino)phenyl]-(2,3,4,5,6-pentadeuteriophenyl)methyl]-N,N-dimethylaniline. InChIKey: WZKXBGJNNCGHIC-OOBYGUTHSA-N.
| Molecular formula | C23H26N2 |
|---|---|
| Molecular weight | 336.5 g/mol |
| IUPAC name | 4-[deuterio-[4-(dimethylamino)phenyl]-(2,3,4,5,6-pentadeuteriophenyl)methyl]-N,N-dimethylaniline |
| InChIKey | WZKXBGJNNCGHIC-OOBYGUTHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])(C2=CC=C(C=C2)N(C)C)C3=CC=C(C=C3)N(C)C)[2H])[2H] |
Computed by PubChem (NCBI)