CAS 1173021-81-2 appears in our catalog under these names: Ammelide-13C3, Ammelide -13C3, >95% (HPLC), Ammelide–13C3, Ammelide-13C3, 99.85%, 13C3-Ammelide, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress, HPC Standards. Available pack sizes: on request, 0,5mg, 5mg, 1mg, 1 mg, 1x1ml, 1x10mg.
6-amino-(2,4,6-13C3)1H-1,3,5-triazine-2,4-dione (CAS 1173021-81-2) is a chemical compound with the molecular formula C3H4N4O2 and a molecular weight of 131.07 g/mol. IUPAC name: 6-amino-(2,4,6-13C3)1H-1,3,5-triazine-2,4-dione. InChIKey: YSKUZVBSHIWEFK-VMIGTVKRSA-N.
| Molecular formula | C3H4N4O2 |
|---|---|
| Molecular weight | 131.07 g/mol |
| IUPAC name | 6-amino-(2,4,6-13C3)1H-1,3,5-triazine-2,4-dione |
| InChIKey | YSKUZVBSHIWEFK-VMIGTVKRSA-N |
| SMILES | [13C]1(=N[13C](=O)N[13C](=O)N1)N |
Computed by PubChem (NCBI)