CAS 1173021-89-0 appears in our catalog under these names: Difloxacin-d3 HCl, Difloxacin-d3 Hydrochloride Salt, >95% (HPLC), Difloxacin D3 hydrochloride (methyl D3), Difloxacin–d3 hydrochloride, Difloxacin-d3 (hydrochloride), 99.6%. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 2,5mg, 5mg, 10 mg, 5 mg, 1x1ml, 1x10mg.
6-fluoro-1-(4-fluorophenyl)-4-oxo-7-[4-(trideuteriomethyl)piperazin-1-yl]quinoline-3-carboxylic acid;hydrochloride (CAS 1173021-89-0) is a chemical compound with the molecular formula C21H20ClF2N3O3 and a molecular weight of 438.9 g/mol. IUPAC name: 6-fluoro-1-(4-fluorophenyl)-4-oxo-7-[4-(trideuteriomethyl)piperazin-1-yl]quinoline-3-carboxylic acid;hydrochloride. InChIKey: JFMGBGLSDVIOHL-NIIDSAIPSA-N.
| Molecular formula | C21H20ClF2N3O3 |
|---|---|
| Molecular weight | 438.9 g/mol |
| IUPAC name | 6-fluoro-1-(4-fluorophenyl)-4-oxo-7-[4-(trideuteriomethyl)piperazin-1-yl]quinoline-3-carboxylic acid;hydrochloride |
| InChIKey | JFMGBGLSDVIOHL-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN(CC1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)O)C4=CC=C(C=C4)F)F.Cl |
Computed by PubChem (NCBI)