Products 1173022-14-4
CAS 1173022-14-4 appears in our catalog under these names: n-Octyl-d17-amine, 98 atom % D, min 98% Chemical Purity, Octan–1–amine–d17, Octan-1-amine-d17, 99.0%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1mg, 10mg, 5mg, 10 mg, 5 mg, 1 mg.
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctan-1-amine (CAS 1173022-14-4) is a chemical compound with the molecular formula C8H19N and a molecular weight of 146.35 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctan-1-amine. InChIKey: IOQPZZOEVPZRBK-OISRNESJSA-N.
| Molecular formula | C8H19N |
|---|---|
| Molecular weight | 146.35 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctan-1-amine |
| InChIKey | IOQPZZOEVPZRBK-OISRNESJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])N |
Computed by PubChem (NCBI)