CAS 1173022-90-6 appears in our catalog under these names: Sodium Dichloroacetate-13C2, 98% 98%atom%13C, Sodium Dichloroacetate-13C2, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 1mg, 5mg.
Sodium 2,2-dichloroacetate (CAS 1173022-90-6) is a chemical compound with the molecular formula C2HCl2NaO2 and a molecular weight of 152.91 g/mol. IUPAC name: sodium 2,2-dichloroacetate. InChIKey: LUPNKHXLFSSUGS-AWQJXPNKSA-M.
| Molecular formula | C2HCl2NaO2 |
|---|---|
| Molecular weight | 152.91 g/mol |
| IUPAC name | sodium 2,2-dichloroacetate |
| InChIKey | LUPNKHXLFSSUGS-AWQJXPNKSA-M |
| SMILES | [13CH]([13C](=O)[O-])(Cl)Cl.[Na+] |
Computed by PubChem (NCBI)