Products 117309-49-6

CAS 117309-49-6 is the registry number for 2-([(4-Fluorophenyl)sulfonyl]amino)-2-phenylacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

2-[(4-fluorophenyl)sulfonylamino]-2-phenylacetic acid (CAS 117309-49-6) is a chemical compound with the molecular formula C14H12FNO4S and a molecular weight of 309.31 g/mol. IUPAC name: 2-[(4-fluorophenyl)sulfonylamino]-2-phenylacetic acid. InChIKey: RDYJUVZFLCNBPH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12FNO4S
Molecular weight309.31 g/mol
IUPAC name2-[(4-fluorophenyl)sulfonylamino]-2-phenylacetic acid
InChIKeyRDYJUVZFLCNBPH-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(C(=O)O)NS(=O)(=O)C2=CC=C(C=C2)F

Computed by PubChem (NCBI)