CAS 1173147-93-7 appears in our catalog under these names: Difloxacin-d3 (methyl-d3), >95% (HPLC), Difloxacin-d3 (methyl-d3), 99 atom % D, min 98% Chemical Purity, Difloxacin–d3, Difloxacin-d3, Difloxacin-d3, 98.0%. Offered by: TRC, CDN, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 0,01g, 0,005g, 1mg, 25mg, 50mg, 1 mg.
6-fluoro-1-(4-fluorophenyl)-4-oxo-7-[4-(trideuteriomethyl)piperazin-1-yl]quinoline-3-carboxylic acid (CAS 1173147-93-7) is a chemical compound with the molecular formula C21H19F2N3O3 and a molecular weight of 402.4 g/mol. IUPAC name: 6-fluoro-1-(4-fluorophenyl)-4-oxo-7-[4-(trideuteriomethyl)piperazin-1-yl]quinoline-3-carboxylic acid. InChIKey: NOCJXYPHIIZEHN-FIBGUPNXSA-N.
| Molecular formula | C21H19F2N3O3 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | 6-fluoro-1-(4-fluorophenyl)-4-oxo-7-[4-(trideuteriomethyl)piperazin-1-yl]quinoline-3-carboxylic acid |
| InChIKey | NOCJXYPHIIZEHN-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN(CC1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)O)C4=CC=C(C=C4)F)F |
Computed by PubChem (NCBI)