Products 1173157-56-6
CAS 1173157-56-6 is the registry number for 1-(6-Bromo-1H-indol-3-yl)-2-methylpropan-2-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(6-bromo-1H-indol-3-yl)-2-methylpropan-2-amine (CAS 1173157-56-6) is a chemical compound with the molecular formula C12H15BrN2 and a molecular weight of 267.16 g/mol. IUPAC name: 1-(6-bromo-1H-indol-3-yl)-2-methylpropan-2-amine. InChIKey: LAPYRIMXQGIHPR-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2 |
|---|---|
| Molecular weight | 267.16 g/mol |
| IUPAC name | 1-(6-bromo-1H-indol-3-yl)-2-methylpropan-2-amine |
| InChIKey | LAPYRIMXQGIHPR-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CNC2=C1C=CC(=C2)Br)N |
Computed by PubChem (NCBI)