CAS 2105313-41-3 is the registry number for 4-Bromo-1'-methylspiro[indoline-3,3'-pyrrolidine], 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine] (CAS 2105313-41-3) is a chemical compound with the molecular formula C12H15BrN2 and a molecular weight of 267.16 g/mol. IUPAC name: 4-bromo-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine]. InChIKey: VVSSLXCVTOHHGO-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2 |
|---|---|
| Molecular weight | 267.16 g/mol |
| IUPAC name | 4-bromo-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine] |
| InChIKey | VVSSLXCVTOHHGO-UHFFFAOYSA-N |
| SMILES | CN1CCC2(C1)CNC3=C2C(=CC=C3)Br |
Computed by PubChem (NCBI)