CAS 1173188-30-1 is the registry number for 6,6’-Dihydroxy-5,5’-dimethoxy-2,2’-diphenic Acid Dimethyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
Methyl 3-hydroxy-2-(2-hydroxy-3-methoxy-6-methoxycarbonylphenyl)-4-methoxybenzoate (CAS 1173188-30-1) is a chemical compound with the molecular formula C18H18O8 and a molecular weight of 362.3 g/mol. IUPAC name: methyl 3-hydroxy-2-(2-hydroxy-3-methoxy-6-methoxycarbonylphenyl)-4-methoxybenzoate. InChIKey: XMKQVLITHCFFGZ-UHFFFAOYSA-N.
| Molecular formula | C18H18O8 |
|---|---|
| Molecular weight | 362.3 g/mol |
| IUPAC name | methyl 3-hydroxy-2-(2-hydroxy-3-methoxy-6-methoxycarbonylphenyl)-4-methoxybenzoate |
| InChIKey | XMKQVLITHCFFGZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)OC)C2=C(C=CC(=C2O)OC)C(=O)OC)O |
Computed by PubChem (NCBI)