CAS 117346-07-3 is the registry number for N-(2-Hydroxy-4-nitrophenyl)phthalimide. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
2-(2-hydroxy-4-nitrophenyl)isoindole-1,3-dione (CAS 117346-07-3) is a chemical compound with the molecular formula C14H8N2O5 and a molecular weight of 284.22 g/mol. IUPAC name: 2-(2-hydroxy-4-nitrophenyl)isoindole-1,3-dione. InChIKey: FOKQLZFZMUOLSZ-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O5 |
|---|---|
| Molecular weight | 284.22 g/mol |
| IUPAC name | 2-(2-hydroxy-4-nitrophenyl)isoindole-1,3-dione |
| InChIKey | FOKQLZFZMUOLSZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=C(C=C(C=C3)[N+](=O)[O-])O |
Computed by PubChem (NCBI)