CAS 1173674-58-2 appears in our catalog under these names: N-9H-Purin-6-yl-l-tryptophan, 95%, (9H-Purin-6-yl)-L-tryptophan, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(2S)-3-(1H-indol-3-yl)-2-(7H-purin-6-ylamino)propanoic acid (CAS 1173674-58-2) is a chemical compound with the molecular formula C16H14N6O2 and a molecular weight of 322.32 g/mol. IUPAC name: (2S)-3-(1H-indol-3-yl)-2-(7H-purin-6-ylamino)propanoic acid. InChIKey: GKAZDIDTEUPDLX-LBPRGKRZSA-N.
| Molecular formula | C16H14N6O2 |
|---|---|
| Molecular weight | 322.32 g/mol |
| IUPAC name | (2S)-3-(1H-indol-3-yl)-2-(7H-purin-6-ylamino)propanoic acid |
| InChIKey | GKAZDIDTEUPDLX-LBPRGKRZSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)O)NC3=NC=NC4=C3NC=N4 |
Computed by PubChem (NCBI)