Products 117369-92-3

CAS 117369-92-3 is the registry number for Methyl 2-Hydroxy-3,5-dimethylbenzoate, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-hydroxy-3,5-dimethylbenzoate (CAS 117369-92-3) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: methyl 2-hydroxy-3,5-dimethylbenzoate. InChIKey: MDKRUWLGYSFHKW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O3
Molecular weight180.20 g/mol
IUPAC namemethyl 2-hydroxy-3,5-dimethylbenzoate
InChIKeyMDKRUWLGYSFHKW-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)C(=O)OC)O)C

Computed by PubChem (NCBI)