CAS 117369-92-3 is the registry number for Methyl 2-Hydroxy-3,5-dimethylbenzoate, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-hydroxy-3,5-dimethylbenzoate (CAS 117369-92-3) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: methyl 2-hydroxy-3,5-dimethylbenzoate. InChIKey: MDKRUWLGYSFHKW-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | methyl 2-hydroxy-3,5-dimethylbenzoate |
| InChIKey | MDKRUWLGYSFHKW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C(=O)OC)O)C |
Computed by PubChem (NCBI)