CAS 1173976-40-3 appears in our catalog under these names: Gefitinib-d3, >95% (HPLC), Gefitinib-d3, Gefitinib-d3, 98.39%. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
N-(3-chloro-4-fluorophenyl)-6-(3-morpholin-4-ylpropoxy)-7-(trideuteriomethoxy)quinazolin-4-amine (CAS 1173976-40-3) is a chemical compound with the molecular formula C22H24ClFN4O3 and a molecular weight of 449.9 g/mol. IUPAC name: N-(3-chloro-4-fluorophenyl)-6-(3-morpholin-4-ylpropoxy)-7-(trideuteriomethoxy)quinazolin-4-amine. InChIKey: XGALLCVXEZPNRQ-FIBGUPNXSA-N.
| Molecular formula | C22H24ClFN4O3 |
|---|---|
| Molecular weight | 449.9 g/mol |
| IUPAC name | N-(3-chloro-4-fluorophenyl)-6-(3-morpholin-4-ylpropoxy)-7-(trideuteriomethoxy)quinazolin-4-amine |
| InChIKey | XGALLCVXEZPNRQ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C2C(=C1)N=CN=C2NC3=CC(=C(C=C3)F)Cl)OCCCN4CCOCC4 |
Computed by PubChem (NCBI)