Products 1174005-79-8

CAS 1174005-79-8 is the registry number for 3-Bromo-4-fluoro-5-methylaniline 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-bromo-4-fluoro-5-methylaniline (CAS 1174005-79-8) is a chemical compound with the molecular formula C7H7BrFN and a molecular weight of 204.04 g/mol. IUPAC name: 3-bromo-4-fluoro-5-methylaniline. InChIKey: QZVKPIOMMWAMLG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BrFN
Molecular weight204.04 g/mol
IUPAC name3-bromo-4-fluoro-5-methylaniline
InChIKeyQZVKPIOMMWAMLG-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1F)Br)N

Computed by PubChem (NCBI)