CAS 1174022-64-0 is the registry number for (S)-Chloropheniramine 3,5-Dinitrobenzoic Acid. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
(3S)-3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine;3,5-dinitrobenzoic acid (CAS 1174022-64-0) is a chemical compound with the molecular formula C23H23ClN4O6 and a molecular weight of 486.9 g/mol. IUPAC name: (3S)-3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine;3,5-dinitrobenzoic acid. InChIKey: JSXNSMMRWKWCFR-RSAXXLAASA-N.
| Molecular formula | C23H23ClN4O6 |
|---|---|
| Molecular weight | 486.9 g/mol |
| IUPAC name | (3S)-3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine;3,5-dinitrobenzoic acid |
| InChIKey | JSXNSMMRWKWCFR-RSAXXLAASA-N |
| SMILES | CN(C)CC[C@@H](C1=CC=C(C=C1)Cl)C2=CC=CC=N2.C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)