CAS 1174046-90-2 appears in our catalog under these names: 4-Ethoxy-1-(4-fluorophenyl)-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 98%, 98%, 4-ETHOXY-1-(4-FLUOROPHENYL)-2-OXO-1,2-DIHYDROPYRIDINE-3-CARBOXYLIC ACID, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-ethoxy-1-(4-fluorophenyl)-2-oxopyridine-3-carboxylic acid (CAS 1174046-90-2) is a chemical compound with the molecular formula C14H12FNO4 and a molecular weight of 277.25 g/mol. IUPAC name: 4-ethoxy-1-(4-fluorophenyl)-2-oxopyridine-3-carboxylic acid. InChIKey: VKBUNAAZMHGGFV-UHFFFAOYSA-N.
| Molecular formula | C14H12FNO4 |
|---|---|
| Molecular weight | 277.25 g/mol |
| IUPAC name | 4-ethoxy-1-(4-fluorophenyl)-2-oxopyridine-3-carboxylic acid |
| InChIKey | VKBUNAAZMHGGFV-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=O)N(C=C1)C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)