CAS 117405-58-0 appears in our catalog under these names: P-3FAX-Neu5Ac, >95% (HPLC), P–3FAX–Neu5Ac, P-3FAX-Neu5Ac/ 97.08% (existing batch purity), 2,4,7,8,9-Penta-O-acetyl-N-acetyl-3-fluoro-b-D-neuraminic acid methyl ester, Sialyltransferase Inhibitor, 1PC X 10MG. Offered by: TRC, GLPBio, TargetMol, Biosynth, Sigma-Aldrich. Available pack sizes: 1mg, 2,5mg, 5mg, 10mg, 25mg, 100mg, 50mg, 5 mg.
Methyl 5-acetamido-2,4-diacetyloxy-3-fluoro-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (CAS 117405-58-0) is a chemical compound with the molecular formula C22H30FNO14 and a molecular weight of 551.5 g/mol. IUPAC name: methyl 5-acetamido-2,4-diacetyloxy-3-fluoro-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate. InChIKey: COXHVKPJIOSDPS-RTEYEINBSA-N.
| Molecular formula | C22H30FNO14 |
|---|---|
| Molecular weight | 551.5 g/mol |
| IUPAC name | methyl 5-acetamido-2,4-diacetyloxy-3-fluoro-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| InChIKey | COXHVKPJIOSDPS-RTEYEINBSA-N |
| SMILES | CC(=O)NC1C(C(C(OC1[C@@H]([C@@H](COC(=O)C)OC(=O)C)OC(=O)C)(C(=O)OC)OC(=O)C)F)OC(=O)C |
Computed by PubChem (NCBI)