CAS 1174130-61-0 appears in our catalog under these names: Aticaprant/ 99.93% (existing batch purity), CERC–501, 4-[4-[[(2S)-2-(3,5-Dimethylphenyl)-1-pyrrolidinyl]methyl]phenoxy]-3-fluorobenzamide, 99%, 99%, Aticaprant, 99.59%, Aticaprant (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Ambeed. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 20mg.
4-[4-[[(2S)-2-(3,5-dimethylphenyl)pyrrolidin-1-yl]methyl]phenoxy]-3-fluorobenzamide (CAS 1174130-61-0) is a chemical compound with the molecular formula C26H27FN2O2 and a molecular weight of 418.5 g/mol. IUPAC name: 4-[4-[[(2S)-2-(3,5-dimethylphenyl)pyrrolidin-1-yl]methyl]phenoxy]-3-fluorobenzamide. InChIKey: ZHPMYDSXGRRERG-DEOSSOPVSA-N.
| Molecular formula | C26H27FN2O2 |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | 4-[4-[[(2S)-2-(3,5-dimethylphenyl)pyrrolidin-1-yl]methyl]phenoxy]-3-fluorobenzamide |
| InChIKey | ZHPMYDSXGRRERG-DEOSSOPVSA-N |
| SMILES | CC1=CC(=CC(=C1)[C@@H]2CCCN2CC3=CC=C(C=C3)OC4=C(C=C(C=C4)C(=O)N)F)C |
Computed by PubChem (NCBI)