CAS 1174131-27-1 appears in our catalog under these names: Sacubitril Impurity 35, Valsartan Impurity 92, Valsartan Impurity 100. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2R,4S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pentanoate (CAS 1174131-27-1) is a chemical compound with the molecular formula C24H31NO4 and a molecular weight of 397.5 g/mol. IUPAC name: methyl (2R,4S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pentanoate. InChIKey: GDQHKJSTCCCZFD-UTKZUKDTSA-N.
| Molecular formula | C24H31NO4 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | methyl (2R,4S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pentanoate |
| InChIKey | GDQHKJSTCCCZFD-UTKZUKDTSA-N |
| SMILES | C[C@H](C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)