CAS 117416-56-5 is the registry number for Hexahydro-2H-cyclopenta[d]oxazol-2-one, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
(3aS,6aR)-3,3a,4,5,6,6a-hexahydrocyclopenta[d][1,3]oxazol-2-one (CAS 117416-56-5) is a chemical compound with the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. IUPAC name: (3aS,6aR)-3,3a,4,5,6,6a-hexahydrocyclopenta[d][1,3]oxazol-2-one. InChIKey: BYBIMGJXEDBVDP-CRCLSJGQSA-N.
| Molecular formula | C6H9NO2 |
|---|---|
| Molecular weight | 127.14 g/mol |
| IUPAC name | (3aS,6aR)-3,3a,4,5,6,6a-hexahydrocyclopenta[d][1,3]oxazol-2-one |
| InChIKey | BYBIMGJXEDBVDP-CRCLSJGQSA-N |
| SMILES | C1C[C@H]2[C@@H](C1)OC(=O)N2 |
Computed by PubChem (NCBI)