CAS 1174169-96-0 is the registry number for N–{(1–(6,7–Dimethoxy–4–quinazolinyl)–4–piperidinyl)methyl}sulfuric diamide. Offered by: GLPBio. Available pack sizes: 10mg.
6,7-dimethoxy-4-[4-[(sulfamoylamino)methyl]piperidin-1-yl]quinazoline (CAS 1174169-96-0) is a chemical compound with the molecular formula C16H23N5O4S and a molecular weight of 381.5 g/mol. IUPAC name: 6,7-dimethoxy-4-[4-[(sulfamoylamino)methyl]piperidin-1-yl]quinazoline. InChIKey: FJQGFNBIJJYDFG-UHFFFAOYSA-N.
| Molecular formula | C16H23N5O4S |
|---|---|
| Molecular weight | 381.5 g/mol |
| IUPAC name | 6,7-dimethoxy-4-[4-[(sulfamoylamino)methyl]piperidin-1-yl]quinazoline |
| InChIKey | FJQGFNBIJJYDFG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)N3CCC(CC3)CNS(=O)(=O)N)OC |
Computed by PubChem (NCBI)