CAS 1174182-24-1 is the registry number for PP1 Analog IV, 3-IB-PP1 1PC X 10MG. Offered by: Sigma-Aldrich. Available pack sizes: 10MG.
1-tert-butyl-3-[(3-iodophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine (CAS 1174182-24-1) is a chemical compound with the molecular formula C16H18IN5 and a molecular weight of 407.25 g/mol. IUPAC name: 1-tert-butyl-3-[(3-iodophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: CVRIGUMSLGSWEZ-UHFFFAOYSA-N.
| Molecular formula | C16H18IN5 |
|---|---|
| Molecular weight | 407.25 g/mol |
| IUPAC name | 1-tert-butyl-3-[(3-iodophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | CVRIGUMSLGSWEZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C2=NC=NC(=C2C(=N1)CC3=CC(=CC=C3)I)N |
Computed by PubChem (NCBI)