Products 1174182-24-1

CAS 1174182-24-1 is the registry number for PP1 Analog IV, 3-IB-PP1 1PC X 10MG. Offered by: Sigma-Aldrich. Available pack sizes: 10MG.

Structural formula: {0} (CAS {1})

1-tert-butyl-3-[(3-iodophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine (CAS 1174182-24-1) is a chemical compound with the molecular formula C16H18IN5 and a molecular weight of 407.25 g/mol. IUPAC name: 1-tert-butyl-3-[(3-iodophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: CVRIGUMSLGSWEZ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H18IN5
Molecular weight407.25 g/mol
IUPAC name1-tert-butyl-3-[(3-iodophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine
InChIKeyCVRIGUMSLGSWEZ-UHFFFAOYSA-N
SMILESCC(C)(C)N1C2=NC=NC(=C2C(=N1)CC3=CC(=CC=C3)I)N

Computed by PubChem (NCBI)